C15H18ClNO2 — CID 117448942
3-[(4-chloro-7-methoxy-1-benzofuran-5-yl)methyl]piperidine (PubChem CID 117448942) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-[(4-chloro-7-methoxy-1-benzofuran-5-yl)methyl]piperidine.
| Compound Name | 3-[(4-chloro-7-methoxy-1-benzofuran-5-yl)methyl]piperidine |
|---|---|
| PubChem CID | 117448942 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[(4-chloro-7-methoxy-1-benzofuran-5-yl)methyl]piperidine |
| SMILES | COc1cc(CC2CCCNC2)c(Cl)c2ccoc12 |
| InChI | InChI=1S/C15H18ClNO2/c1-18-13-8-11(7-10-3-2-5-17-9-10)14(16)12-4-6-19-15(12)13/h4,6,8,10,17H,2-3,5,7,9H2,1H3 |
| InChIKey | PCLOKFSJMDKFRA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |