C10H12BrF2NO — CID 117449379
2-(5-bromo-3,4-difluoro-2-methoxyphenyl)propan-2-amine (PubChem CID 117449379) has the molecular formula C10H12BrF2NO and a molecular weight of 280.11 g/mol. Its IUPAC name is 2-(5-bromo-3,4-difluoro-2-methoxyphenyl)propan-2-amine.
| Compound Name | 2-(5-bromo-3,4-difluoro-2-methoxyphenyl)propan-2-amine |
|---|---|
| PubChem CID | 117449379 |
| Molecular Formula | C10H12BrF2NO |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-(5-bromo-3,4-difluoro-2-methoxyphenyl)propan-2-amine |
| SMILES | COc1c(C(C)(C)N)cc(Br)c(F)c1F |
| InChI | InChI=1S/C10H12BrF2NO/c1-10(2,14)5-4-6(11)7(12)8(13)9(5)15-3/h4H,14H2,1-3H3 |
| InChIKey | JKZHWKJRERBAAS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|