C11H15ClFNO2 — CID 117372512
2-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)propan-2-amine (PubChem CID 117372512) has the molecular formula C11H15ClFNO2 and a molecular weight of 247.70 g/mol. Its IUPAC name is 2-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)propan-2-amine.
| Compound Name | 2-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)propan-2-amine |
|---|---|
| PubChem CID | 117372512 |
| Molecular Formula | C11H15ClFNO2 |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)propan-2-amine |
| SMILES | COc1c(C(C)(C)N)cc(Cl)c(F)c1OC |
| InChI | InChI=1S/C11H15ClFNO2/c1-11(2,14)6-5-7(12)8(13)10(16-4)9(6)15-3/h5H,14H2,1-4H3 |
| InChIKey | USRVFGIGHHTHGY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |