C14H22ClNO2 — CID 117432460
2-(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)propan-2-amine (PubChem CID 117432460) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 2-(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)propan-2-amine.
| Compound Name | 2-(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 117432460 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)propan-2-amine |
| SMILES | COc1c(Cl)cc(C(C)(C)N)c(C(C)C)c1OC |
| InChI | InChI=1S/C14H22ClNO2/c1-8(2)11-9(14(3,4)16)7-10(15)12(17-5)13(11)18-6/h7-8H,16H2,1-6H3 |
| InChIKey | LOGSMJDGWZMRSC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |