C13H20ClNO2 — CID 117398199
2-(5-chloro-2-ethyl-3,4-dimethoxyphenyl)propan-2-amine (PubChem CID 117398199) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 2-(5-chloro-2-ethyl-3,4-dimethoxyphenyl)propan-2-amine.
| Compound Name | 2-(5-chloro-2-ethyl-3,4-dimethoxyphenyl)propan-2-amine |
|---|---|
| PubChem CID | 117398199 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-(5-chloro-2-ethyl-3,4-dimethoxyphenyl)propan-2-amine |
| SMILES | CCc1c(C(C)(C)N)cc(Cl)c(OC)c1OC |
| InChI | InChI=1S/C13H20ClNO2/c1-6-8-9(13(2,3)15)7-10(14)12(17-5)11(8)16-4/h7H,6,15H2,1-5H3 |
| InChIKey | DVJXJLVPRLVSBT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |