C13H16N2O3S — CID 117450140
5-methoxy-6-(piperazin-1-ylmethyl)-1,3-benzoxathiol-2-one (PubChem CID 117450140) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 5-methoxy-6-(piperazin-1-ylmethyl)-1,3-benzoxathiol-2-one.
| Compound Name | 5-methoxy-6-(piperazin-1-ylmethyl)-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 117450140 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 5-methoxy-6-(piperazin-1-ylmethyl)-1,3-benzoxathiol-2-one |
| SMILES | COc1cc2sc(=O)oc2cc1CN1CCNCC1 |
| InChI | InChI=1S/C13H16N2O3S/c1-17-10-7-12-11(18-13(16)19-12)6-9(10)8-15-4-2-14-3-5-15/h6-7,14H,2-5,8H2,1H3 |
| InChIKey | UCSRJFMTVMMHSX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|