C13H13ClN2O3 — CID 117450694
5-(7-chloro-4-propan-2-yl-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine (PubChem CID 117450694) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 5-(7-chloro-4-propan-2-yl-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(7-chloro-4-propan-2-yl-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117450694 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-(7-chloro-4-propan-2-yl-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine |
| SMILES | CC(C)c1c(-c2cc(N)no2)cc(Cl)c2c1OCO2 |
| InChI | InChI=1S/C13H13ClN2O3/c1-6(2)11-7(9-4-10(15)16-19-9)3-8(14)12-13(11)18-5-17-12/h3-4,6H,5H2,1-2H3,(H2,15,16) |
| InChIKey | FTBLTVZYTYFGJW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |