C13H15NO4S — CID 117451499
5-(1-isocyanatocyclopentyl)-2-methylsulfonylphenol (PubChem CID 117451499) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 5-(1-isocyanatocyclopentyl)-2-methylsulfonylphenol.
| Compound Name | 5-(1-isocyanatocyclopentyl)-2-methylsulfonylphenol |
|---|---|
| PubChem CID | 117451499 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5-(1-isocyanatocyclopentyl)-2-methylsulfonylphenol |
| SMILES | CS(=O)(=O)c1ccc(C2(N=C=O)CCCC2)cc1O |
| InChI | InChI=1S/C13H15NO4S/c1-19(17,18)12-5-4-10(8-11(12)16)13(14-9-15)6-2-3-7-13/h4-5,8,16H,2-3,6-7H2,1H3 |
| InChIKey | RXKAEEFFNDTCCG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|