C12H13NO4S — CID 117421472
2-(1-isocyanatocyclobutyl)-3-methylsulfonylphenol (PubChem CID 117421472) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-(1-isocyanatocyclobutyl)-3-methylsulfonylphenol.
| Compound Name | 2-(1-isocyanatocyclobutyl)-3-methylsulfonylphenol |
|---|---|
| PubChem CID | 117421472 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(1-isocyanatocyclobutyl)-3-methylsulfonylphenol |
| SMILES | CS(=O)(=O)c1cccc(O)c1C1(N=C=O)CCC1 |
| InChI | InChI=1S/C12H13NO4S/c1-18(16,17)10-5-2-4-9(15)11(10)12(13-8-14)6-3-7-12/h2,4-5,15H,3,6-7H2,1H3 |
| InChIKey | MMDZJEFDZNNYCN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|