C17H19N3O — CID 117451607
1-cyclopropyl-5-(1-isocyanatocyclopentyl)-2-methylbenzimidazole (PubChem CID 117451607) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-cyclopropyl-5-(1-isocyanatocyclopentyl)-2-methylbenzimidazole.
| Compound Name | 1-cyclopropyl-5-(1-isocyanatocyclopentyl)-2-methylbenzimidazole |
|---|---|
| PubChem CID | 117451607 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-cyclopropyl-5-(1-isocyanatocyclopentyl)-2-methylbenzimidazole |
| SMILES | Cc1nc2cc(C3(N=C=O)CCCC3)ccc2n1C1CC1 |
| InChI | InChI=1S/C17H19N3O/c1-12-19-15-10-13(17(18-11-21)8-2-3-9-17)4-7-16(15)20(12)14-5-6-14/h4,7,10,14H,2-3,5-6,8-9H2,1H3 |
| InChIKey | DNYMZGLRBQYISL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|