C14H15N3O — CID 117355332
5-(1-isocyanatocyclobutyl)-1,2-dimethylbenzimidazole (PubChem CID 117355332) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-(1-isocyanatocyclobutyl)-1,2-dimethylbenzimidazole.
| Compound Name | 5-(1-isocyanatocyclobutyl)-1,2-dimethylbenzimidazole |
|---|---|
| PubChem CID | 117355332 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 5-(1-isocyanatocyclobutyl)-1,2-dimethylbenzimidazole |
| SMILES | Cc1nc2cc(C3(N=C=O)CCC3)ccc2n1C |
| InChI | InChI=1S/C14H15N3O/c1-10-16-12-8-11(4-5-13(12)17(10)2)14(15-9-18)6-3-7-14/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | GCJGMZLCHLGEMC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|