C10H9N3O — CID 83530473
5-isocyanato-1,2-dimethylbenzimidazole (PubChem CID 83530473) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 5-isocyanato-1,2-dimethylbenzimidazole.
| Compound Name | 5-isocyanato-1,2-dimethylbenzimidazole |
|---|---|
| PubChem CID | 83530473 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 5-isocyanato-1,2-dimethylbenzimidazole |
| SMILES | Cc1nc2cc(N=C=O)ccc2n1C |
| InChI | InChI=1S/C10H9N3O/c1-7-12-9-5-8(11-6-14)3-4-10(9)13(7)2/h3-5H,1-2H3 |
| InChIKey | WQWDYAVSQDMIAC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|