About 6-isocyanato-2,1-benzothiazole
6-isocyanato-2,1-benzothiazole (PubChem CID 169353944) has the molecular formula C8H4N2OS
and a molecular weight of 176.20 g/mol. Its IUPAC name is 6-isocyanato-2,1-benzothiazole.
Molecular Properties
| Compound Name | 6-isocyanato-2,1-benzothiazole |
| PubChem CID | 169353944 |
| Molecular Formula | C8H4N2OS |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 6-isocyanato-2,1-benzothiazole |
| SMILES | O=C=Nc1ccc2csnc2c1 |
| InChI | InChI=1S/C8H4N2OS/c11-5-9-7-2-1-6-4-12-10-8(6)3-7/h1-4H |
| InChIKey | YZLDGTKXHRVKJA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-isocyanato-2,1-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isocyanato-2,1-benzothiazole?
The IUPAC name of 6-isocyanato-2,1-benzothiazole (CID 169353944) is 6-isocyanato-2,1-benzothiazole.
What is the SMILES notation for 6-isocyanato-2,1-benzothiazole?
The canonical SMILES for 6-isocyanato-2,1-benzothiazole is O=C=Nc1ccc2csnc2c1.
What is the InChIKey of 6-isocyanato-2,1-benzothiazole?
The InChIKey is YZLDGTKXHRVKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2OS/c11-5-9-7-2-1-6-4-12-10-8(6)3-7/h1-4H.
What are the key properties of 6-isocyanato-2,1-benzothiazole?
6-isocyanato-2,1-benzothiazole has a molecular weight of 176.20 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isocyanato-2,1-benzothiazole is sourced from PubChem (CID 169353944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).