C7H3N3O4S — CID 134858532
4,6-dinitro-2,1-benzothiazole (PubChem CID 134858532) has the molecular formula C7H3N3O4S and a molecular weight of 225.19 g/mol. Its IUPAC name is 4,6-dinitro-2,1-benzothiazole.
| Compound Name | 4,6-dinitro-2,1-benzothiazole |
|---|---|
| PubChem CID | 134858532 |
| Molecular Formula | C7H3N3O4S |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 4,6-dinitro-2,1-benzothiazole |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2csnc2c1 |
| InChI | InChI=1S/C7H3N3O4S/c11-9(12)4-1-6-5(3-15-8-6)7(2-4)10(13)14/h1-3H |
| InChIKey | TWYDZAZZWLSVRG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|