About 4,6-dinitro-2,1-benzothiazole
4,6-dinitro-2,1-benzothiazole (PubChem CID 134858532) has the molecular formula C7H3N3O4S
and a molecular weight of 225.19 g/mol. Its IUPAC name is 4,6-dinitro-2,1-benzothiazole.
Molecular Properties
| Compound Name | 4,6-dinitro-2,1-benzothiazole |
| PubChem CID | 134858532 |
| Molecular Formula | C7H3N3O4S |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 4,6-dinitro-2,1-benzothiazole |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2csnc2c1 |
| InChI | InChI=1S/C7H3N3O4S/c11-9(12)4-1-6-5(3-15-8-6)7(2-4)10(13)14/h1-3H |
| InChIKey | TWYDZAZZWLSVRG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dinitro-2,1-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dinitro-2,1-benzothiazole?
The IUPAC name of 4,6-dinitro-2,1-benzothiazole (CID 134858532) is 4,6-dinitro-2,1-benzothiazole.
What is the SMILES notation for 4,6-dinitro-2,1-benzothiazole?
The canonical SMILES for 4,6-dinitro-2,1-benzothiazole is O=[N+]([O-])c1cc([N+](=O)[O-])c2csnc2c1.
What is the InChIKey of 4,6-dinitro-2,1-benzothiazole?
The InChIKey is TWYDZAZZWLSVRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N3O4S/c11-9(12)4-1-6-5(3-15-8-6)7(2-4)10(13)14/h1-3H.
What are the key properties of 4,6-dinitro-2,1-benzothiazole?
4,6-dinitro-2,1-benzothiazole has a molecular weight of 225.19 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dinitro-2,1-benzothiazole is sourced from PubChem (CID 134858532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).