C18H23N3 — CID 117451850
9-methyl-7-pyrrolidin-2-yl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 117451850) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 9-methyl-7-pyrrolidin-2-yl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 9-methyl-7-pyrrolidin-2-yl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 117451850 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 9-methyl-7-pyrrolidin-2-yl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | Cn1c2c(c3cccc(C4CCCN4)c31)C1CCN2CC1 |
| InChI | InChI=1S/C18H23N3/c1-20-17-13(15-6-3-9-19-15)4-2-5-14(17)16-12-7-10-21(11-8-12)18(16)20/h2,4-5,12,15,19H,3,6-11H2,1H3 |
| InChIKey | GCDCWLLEVUPYFR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |