C17H18N4O — CID 117474939
3-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)-1,2-oxazol-5-amine (PubChem CID 117474939) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117474939 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)-1,2-oxazol-5-amine |
| SMILES | Cn1c2c(c3cccc(-c4cc(N)on4)c31)C1CCN2CC1 |
| InChI | InChI=1S/C17H18N4O/c1-20-16-11(13-9-14(18)22-19-13)3-2-4-12(16)15-10-5-7-21(8-6-10)17(15)20/h2-4,9-10H,5-8,18H2,1H3 |
| InChIKey | UJRSEYCWBIEKNQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |