C13H10F3N3O — CID 115108348
3-[1-methyl-7-(trifluoromethyl)indol-3-yl]-1,2-oxazol-5-amine (PubChem CID 115108348) has the molecular formula C13H10F3N3O and a molecular weight of 281.24 g/mol. Its IUPAC name is 3-[1-methyl-7-(trifluoromethyl)indol-3-yl]-1,2-oxazol-5-amine.
| Compound Name | 3-[1-methyl-7-(trifluoromethyl)indol-3-yl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 115108348 |
| Molecular Formula | C13H10F3N3O |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-[1-methyl-7-(trifluoromethyl)indol-3-yl]-1,2-oxazol-5-amine |
| SMILES | Cn1cc(-c2cc(N)on2)c2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C13H10F3N3O/c1-19-6-8(10-5-11(17)20-18-10)7-3-2-4-9(12(7)19)13(14,15)16/h2-6H,17H2,1H3 |
| InChIKey | JIGSBLYURPUIQW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |