C13H16ClN3O2 — CID 117452223
4-(2-chloro-3-ethyl-5,6-dimethoxyphenyl)-1H-pyrazol-5-amine (PubChem CID 117452223) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 4-(2-chloro-3-ethyl-5,6-dimethoxyphenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2-chloro-3-ethyl-5,6-dimethoxyphenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117452223 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-(2-chloro-3-ethyl-5,6-dimethoxyphenyl)-1H-pyrazol-5-amine |
| SMILES | CCc1cc(OC)c(OC)c(-c2cn[nH]c2N)c1Cl |
| InChI | InChI=1S/C13H16ClN3O2/c1-4-7-5-9(18-2)12(19-3)10(11(7)14)8-6-16-17-13(8)15/h5-6H,4H2,1-3H3,(H3,15,16,17) |
| InChIKey | SNYWBGDKNZEZMD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |