C11H19NO — CID 11745254
(2S)-2-(methoxymethyl)-1-(3-methylbuta-1,3-dien-2-yl)pyrrolidine (PubChem CID 11745254) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2S)-2-(methoxymethyl)-1-(3-methylbuta-1,3-dien-2-yl)pyrrolidine.
| Compound Name | (2S)-2-(methoxymethyl)-1-(3-methylbuta-1,3-dien-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 11745254 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2S)-2-(methoxymethyl)-1-(3-methylbuta-1,3-dien-2-yl)pyrrolidine |
| SMILES | C=C(C)C(=C)N1CCC[C@H]1COC |
| InChI | InChI=1S/C11H19NO/c1-9(2)10(3)12-7-5-6-11(12)8-13-4/h11H,1,3,5-8H2,2,4H3/t11-/m0/s1 |
| InChIKey | BQHLQIFHXOSJTF-NSHDSACASA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|