C8H14FNO — CID 176568175
(4E)-4-(fluoromethylidene)-2-(methoxymethyl)-1-methylpyrrolidine (PubChem CID 176568175) has the molecular formula C8H14FNO and a molecular weight of 159.20 g/mol. Its IUPAC name is (4E)-4-(fluoromethylidene)-2-(methoxymethyl)-1-methylpyrrolidine.
| Compound Name | (4E)-4-(fluoromethylidene)-2-(methoxymethyl)-1-methylpyrrolidine |
|---|---|
| PubChem CID | 176568175 |
| Molecular Formula | C8H14FNO |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | (4E)-4-(fluoromethylidene)-2-(methoxymethyl)-1-methylpyrrolidine |
| SMILES | COCC1C/C(=C\F)CN1C |
| InChI | InChI=1S/C8H14FNO/c1-10-5-7(4-9)3-8(10)6-11-2/h4,8H,3,5-6H2,1-2H3/b7-4+ |
| InChIKey | HCWAHNLAHSSLHT-QPJJXVBHSA-N |
| XLogP | 1.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |