C10H16ClNO2 — CID 58782033
2-chloro-1-[(2S)-2-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridin-4-yl]ethanone (PubChem CID 58782033) has the molecular formula C10H16ClNO2 and a molecular weight of 217.70 g/mol. Its IUPAC name is 2-chloro-1-[(2S)-2-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridin-4-yl]ethanone.
| Compound Name | 2-chloro-1-[(2S)-2-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridin-4-yl]ethanone |
|---|---|
| PubChem CID | 58782033 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-chloro-1-[(2S)-2-(methoxymethyl)-1-methyl-3,6-dihydro-2H-pyridin-4-yl]ethanone |
| SMILES | COC[C@@H]1CC(C(=O)CCl)=CCN1C |
| InChI | InChI=1S/C10H16ClNO2/c1-12-4-3-8(10(13)6-11)5-9(12)7-14-2/h3,9H,4-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | NGKYBPDUDRMXKV-VIFPVBQESA-N |
| XLogP | 1.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|