C14H18O4S — CID 117453854
methyl 2-hydroxy-2-[3-(thian-3-yloxy)phenyl]acetate (PubChem CID 117453854) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[3-(thian-3-yloxy)phenyl]acetate.
| Compound Name | methyl 2-hydroxy-2-[3-(thian-3-yloxy)phenyl]acetate |
|---|---|
| PubChem CID | 117453854 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl 2-hydroxy-2-[3-(thian-3-yloxy)phenyl]acetate |
| SMILES | COC(=O)C(O)c1cccc(OC2CCCSC2)c1 |
| InChI | InChI=1S/C14H18O4S/c1-17-14(16)13(15)10-4-2-5-11(8-10)18-12-6-3-7-19-9-12/h2,4-5,8,12-13,15H,3,6-7,9H2,1H3 |
| InChIKey | NUVKRUSXJNRSDV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |