C15H21NOS — CID 117413862
1-[3-(thian-3-yloxy)phenyl]cyclobutan-1-amine (PubChem CID 117413862) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-[3-(thian-3-yloxy)phenyl]cyclobutan-1-amine.
| Compound Name | 1-[3-(thian-3-yloxy)phenyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 117413862 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-[3-(thian-3-yloxy)phenyl]cyclobutan-1-amine |
| SMILES | NC1(c2cccc(OC3CCCSC3)c2)CCC1 |
| InChI | InChI=1S/C15H21NOS/c16-15(7-3-8-15)12-4-1-5-13(10-12)17-14-6-2-9-18-11-14/h1,4-5,10,14H,2-3,6-9,11,16H2 |
| InChIKey | DMCAFIVJZUOEPZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |