C17H25NOS — CID 117470997
3-[[3-(thian-3-yloxy)phenyl]methyl]piperidine (PubChem CID 117470997) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is 3-[[3-(thian-3-yloxy)phenyl]methyl]piperidine.
| Compound Name | 3-[[3-(thian-3-yloxy)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 117470997 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-[[3-(thian-3-yloxy)phenyl]methyl]piperidine |
| SMILES | c1cc(CC2CCCNC2)cc(OC2CCCSC2)c1 |
| InChI | InChI=1S/C17H25NOS/c1-4-14(10-15-5-2-8-18-12-15)11-16(6-1)19-17-7-3-9-20-13-17/h1,4,6,11,15,17-18H,2-3,5,7-10,12-13H2 |
| InChIKey | RQUDTTRQHVXLEG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |