C13H19N — CID 39345685
(3S)-3-[(3-methylphenyl)methyl]piperidine (PubChem CID 39345685) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (3S)-3-[(3-methylphenyl)methyl]piperidine.
| Compound Name | (3S)-3-[(3-methylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 39345685 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3S)-3-[(3-methylphenyl)methyl]piperidine |
| SMILES | Cc1cccc(C[C@@H]2CCCNC2)c1 |
| InChI | InChI=1S/C13H19N/c1-11-4-2-5-12(8-11)9-13-6-3-7-14-10-13/h2,4-5,8,13-14H,3,6-7,9-10H2,1H3/t13-/m0/s1 |
| InChIKey | QGDXLGZYLHVIMJ-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |