C16H24 — CID 167535995
1-[(3-ethylcyclohexyl)methyl]-3-methylbenzene (PubChem CID 167535995) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-[(3-ethylcyclohexyl)methyl]-3-methylbenzene.
| Compound Name | 1-[(3-ethylcyclohexyl)methyl]-3-methylbenzene |
|---|---|
| PubChem CID | 167535995 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1-[(3-ethylcyclohexyl)methyl]-3-methylbenzene |
| SMILES | CCC1CCCC(Cc2cccc(C)c2)C1 |
| InChI | InChI=1S/C16H24/c1-3-14-7-5-9-16(11-14)12-15-8-4-6-13(2)10-15/h4,6,8,10,14,16H,3,5,7,9,11-12H2,1-2H3 |
| InChIKey | JIFVGDUGTPBZHX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |