C18H26O2 — CID 67980113
2-[3-[(3-ethylcyclohexyl)methyl]phenyl]-1,3-dioxolane (PubChem CID 67980113) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 2-[3-[(3-ethylcyclohexyl)methyl]phenyl]-1,3-dioxolane.
| Compound Name | 2-[3-[(3-ethylcyclohexyl)methyl]phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 67980113 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-[3-[(3-ethylcyclohexyl)methyl]phenyl]-1,3-dioxolane |
| SMILES | CCC1CCCC(Cc2cccc(C3OCCO3)c2)C1 |
| InChI | InChI=1S/C18H26O2/c1-2-14-5-3-6-15(11-14)12-16-7-4-8-17(13-16)18-19-9-10-20-18/h4,7-8,13-15,18H,2-3,5-6,9-12H2,1H3 |
| InChIKey | GKDVUSYFQCBAQE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |