C24H40O3 — CID 88539733
1,1-diethoxyethane;ethene;3-[(3-ethylcyclohexyl)methyl]benzaldehyde (PubChem CID 88539733) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 1,1-diethoxyethane;ethene;3-[(3-ethylcyclohexyl)methyl]benzaldehyde.
| Compound Name | 1,1-diethoxyethane;ethene;3-[(3-ethylcyclohexyl)methyl]benzaldehyde |
|---|---|
| PubChem CID | 88539733 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 1,1-diethoxyethane;ethene;3-[(3-ethylcyclohexyl)methyl]benzaldehyde |
| SMILES | C=C.CCC1CCCC(Cc2cccc(C=O)c2)C1.CCOC(C)OCC |
| InChI | InChI=1S/C16H22O.C6H14O2.C2H4/c1-2-13-5-3-6-14(9-13)10-15-7-4-8-16(11-15)12-17;1-4-7-6(3)8-5-2;1-2/h4,7-8,11-14H,2-3,5-6,9-10H2,1H3;6H,4-5H2,1-3H3;1-2H2 |
| InChIKey | LUEAZGIYXJFCDV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|