C22H31NO3 — CID 88650579
1,1-diethoxyethane;ethene;3-(2-pyridin-3-ylethyl)benzaldehyde (PubChem CID 88650579) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 1,1-diethoxyethane;ethene;3-(2-pyridin-3-ylethyl)benzaldehyde.
| Compound Name | 1,1-diethoxyethane;ethene;3-(2-pyridin-3-ylethyl)benzaldehyde |
|---|---|
| PubChem CID | 88650579 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1,1-diethoxyethane;ethene;3-(2-pyridin-3-ylethyl)benzaldehyde |
| SMILES | C=C.CCOC(C)OCC.O=Cc1cccc(CCc2cccnc2)c1 |
| InChI | InChI=1S/C14H13NO.C6H14O2.C2H4/c16-11-14-4-1-3-12(9-14)6-7-13-5-2-8-15-10-13;1-4-7-6(3)8-5-2;1-2/h1-5,8-11H,6-7H2;6H,4-5H2,1-3H3;1-2H2 |
| InChIKey | ALLGUUHHBWJPPJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|