About pyridine-3-carbaldehyde;triethylborane
pyridine-3-carbaldehyde;triethylborane (PubChem CID 10976604) has the molecular formula C12H20BNO
and a molecular weight of 205.11 g/mol. Its IUPAC name is pyridine-3-carbaldehyde;triethylborane.
Molecular Properties
| Compound Name | pyridine-3-carbaldehyde;triethylborane |
| PubChem CID | 10976604 |
| Molecular Formula | C12H20BNO |
| Molecular Weight | 205.11 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | pyridine-3-carbaldehyde;triethylborane |
| SMILES | CCB(CC)CC.O=Cc1cccnc1 |
| InChI | InChI=1S/C6H15B.C6H5NO/c1-4-7(5-2)6-3;8-5-6-2-1-3-7-4-6/h4-6H2,1-3H3;1-5H |
| InChIKey | SJZYWQSSXVFVQR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze pyridine-3-carbaldehyde;triethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-3-carbaldehyde;triethylborane?
The IUPAC name of pyridine-3-carbaldehyde;triethylborane (CID 10976604) is pyridine-3-carbaldehyde;triethylborane.
What is the SMILES notation for pyridine-3-carbaldehyde;triethylborane?
The canonical SMILES for pyridine-3-carbaldehyde;triethylborane is CCB(CC)CC.O=Cc1cccnc1.
What is the InChIKey of pyridine-3-carbaldehyde;triethylborane?
The InChIKey is SJZYWQSSXVFVQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15B.C6H5NO/c1-4-7(5-2)6-3;8-5-6-2-1-3-7-4-6/h4-6H2,1-3H3;1-5H.
What are the key properties of pyridine-3-carbaldehyde;triethylborane?
pyridine-3-carbaldehyde;triethylborane has a molecular weight of 205.11 g/mol, XLogP of 3.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-3-carbaldehyde;triethylborane is sourced from PubChem (CID 10976604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).