About dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde
dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde (PubChem CID 161103202) has the molecular formula C19H20NO4P
and a molecular weight of 357.35 g/mol. Its IUPAC name is dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde |
| PubChem CID | 161103202 |
| Molecular Formula | C19H20NO4P |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde |
| SMILES | COP(O)(O)(c1ccccc1)c1ccccc1.O=Cc1cccnc1 |
| InChI | InChI=1S/C13H15O3P.C6H5NO/c1-16-17(14,15,12-8-4-2-5-9-12)13-10-6-3-7-11-13;8-5-6-2-1-3-7-4-6/h2-11,14-15H,1H3;1-5H |
| InChIKey | UIRYTCONDLFXRT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde?
The IUPAC name of dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde (CID 161103202) is dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde.
What is the SMILES notation for dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde?
The canonical SMILES for dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde is COP(O)(O)(c1ccccc1)c1ccccc1.O=Cc1cccnc1.
What is the InChIKey of dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde?
The InChIKey is UIRYTCONDLFXRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15O3P.C6H5NO/c1-16-17(14,15,12-8-4-2-5-9-12)13-10-6-3-7-11-13;8-5-6-2-1-3-7-4-6/h2-11,14-15H,1H3;1-5H.
What are the key properties of dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde?
dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde has a molecular weight of 357.35 g/mol, XLogP of 2.46, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy-methoxy-diphenyl-λ5-phosphane;pyridine-3-carbaldehyde is sourced from PubChem (CID 161103202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).