About isoquinoline-4-carbaldehyde;triethylborane
isoquinoline-4-carbaldehyde;triethylborane (PubChem CID 10868869) has the molecular formula C16H22BNO
and a molecular weight of 255.17 g/mol. Its IUPAC name is isoquinoline-4-carbaldehyde;triethylborane.
Molecular Properties
| Compound Name | isoquinoline-4-carbaldehyde;triethylborane |
| PubChem CID | 10868869 |
| Molecular Formula | C16H22BNO |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | isoquinoline-4-carbaldehyde;triethylborane |
| SMILES | CCB(CC)CC.O=Cc1cncc2ccccc12 |
| InChI | InChI=1S/C10H7NO.C6H15B/c12-7-9-6-11-5-8-3-1-2-4-10(8)9;1-4-7(5-2)6-3/h1-7H;4-6H2,1-3H3 |
| InChIKey | OIRKFDYFGSUQLZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze isoquinoline-4-carbaldehyde;triethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline-4-carbaldehyde;triethylborane?
The IUPAC name of isoquinoline-4-carbaldehyde;triethylborane (CID 10868869) is isoquinoline-4-carbaldehyde;triethylborane.
What is the SMILES notation for isoquinoline-4-carbaldehyde;triethylborane?
The canonical SMILES for isoquinoline-4-carbaldehyde;triethylborane is CCB(CC)CC.O=Cc1cncc2ccccc12.
What is the InChIKey of isoquinoline-4-carbaldehyde;triethylborane?
The InChIKey is OIRKFDYFGSUQLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO.C6H15B/c12-7-9-6-11-5-8-3-1-2-4-10(8)9;1-4-7(5-2)6-3/h1-7H;4-6H2,1-3H3.
What are the key properties of isoquinoline-4-carbaldehyde;triethylborane?
isoquinoline-4-carbaldehyde;triethylborane has a molecular weight of 255.17 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline-4-carbaldehyde;triethylborane is sourced from PubChem (CID 10868869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).