C13H15ClN2O3 — CID 117454242
5-(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)-1,2-oxazol-3-amine (PubChem CID 117454242) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 5-(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117454242 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1cc(Cl)cc(-c2cc(N)no2)c1OC(C)C |
| InChI | InChI=1S/C13H15ClN2O3/c1-7(2)18-13-9(10-6-12(15)16-19-10)4-8(14)5-11(13)17-3/h4-7H,1-3H3,(H2,15,16) |
| InChIKey | HZIODZMOBRCQEC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |