C14H18N2O4 — CID 117446006
5-(2,5-dimethoxy-4-propan-2-yloxyphenyl)-1,2-oxazol-3-amine (PubChem CID 117446006) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-(2,5-dimethoxy-4-propan-2-yloxyphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2,5-dimethoxy-4-propan-2-yloxyphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117446006 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 5-(2,5-dimethoxy-4-propan-2-yloxyphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1cc(-c2cc(N)no2)c(OC)cc1OC(C)C |
| InChI | InChI=1S/C14H18N2O4/c1-8(2)19-13-6-10(17-3)9(5-12(13)18-4)11-7-14(15)16-20-11/h5-8H,1-4H3,(H2,15,16) |
| InChIKey | QAAMIKFFRUMLDQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |