C11H11FN2O4S — CID 117461607
5-(5-fluoro-2-methoxy-4-methylsulfonylphenyl)-1,2-oxazol-3-amine (PubChem CID 117461607) has the molecular formula C11H11FN2O4S and a molecular weight of 286.28 g/mol. Its IUPAC name is 5-(5-fluoro-2-methoxy-4-methylsulfonylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(5-fluoro-2-methoxy-4-methylsulfonylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117461607 |
| Molecular Formula | C11H11FN2O4S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 5-(5-fluoro-2-methoxy-4-methylsulfonylphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1cc(S(C)(=O)=O)c(F)cc1-c1cc(N)no1 |
| InChI | InChI=1S/C11H11FN2O4S/c1-17-8-4-10(19(2,15)16)7(12)3-6(8)9-5-11(13)14-18-9/h3-5H,1-2H3,(H2,13,14) |
| InChIKey | DOWAGAPYLXLSRY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |