C11H10F2N2O3 — CID 117393407
5-(2,6-difluoro-3,5-dimethoxyphenyl)-1,2-oxazol-3-amine (PubChem CID 117393407) has the molecular formula C11H10F2N2O3 and a molecular weight of 256.21 g/mol. Its IUPAC name is 5-(2,6-difluoro-3,5-dimethoxyphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2,6-difluoro-3,5-dimethoxyphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117393407 |
| Molecular Formula | C11H10F2N2O3 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 5-(2,6-difluoro-3,5-dimethoxyphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1cc(OC)c(F)c(-c2cc(N)no2)c1F |
| InChI | InChI=1S/C11H10F2N2O3/c1-16-6-3-7(17-2)11(13)9(10(6)12)5-4-8(14)15-18-5/h3-4H,1-2H3,(H2,14,15) |
| InChIKey | VFJBPVRXFCECCD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |