About methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate
methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate (PubChem CID 11745738) has the molecular formula C8H13NO3S
and a molecular weight of 203.26 g/mol. Its IUPAC name is methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate.
Analyze methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate?
The IUPAC name of methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate (CID 11745738) is methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate is COC(=O)[C@@H]1CS[C@H](C)N1C(C)=O.
What is the InChIKey of methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate?
The InChIKey is NNTOZPLXZHWPRU-RQJHMYQMSA-N. The full InChI is InChI=1S/C8H13NO3S/c1-5(10)9-6(2)13-4-7(9)8(11)12-3/h6-7H,4H2,1-3H3/t6-,7+/m1/s1.
What are the key properties of methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate?
methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate has a molecular weight of 203.26 g/mol, XLogP of 0.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,4R)-3-acetyl-2-methyl-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 11745738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).