C13H16O5S — CID 117457810
2-[1-(2-methoxy-6-methylsulfonylphenyl)cyclopropyl]acetic acid (PubChem CID 117457810) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is 2-[1-(2-methoxy-6-methylsulfonylphenyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(2-methoxy-6-methylsulfonylphenyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 117457810 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-[1-(2-methoxy-6-methylsulfonylphenyl)cyclopropyl]acetic acid |
| SMILES | COc1cccc(S(C)(=O)=O)c1C1(CC(=O)O)CC1 |
| InChI | InChI=1S/C13H16O5S/c1-18-9-4-3-5-10(19(2,16)17)12(9)13(6-7-13)8-11(14)15/h3-5H,6-8H2,1-2H3,(H,14,15) |
| InChIKey | FLWRXHMZFOXVNJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |