C15H21ClO3 — CID 117458641
2-(2-chloro-4-cyclopentyloxy-5-methoxyphenyl)propan-1-ol (PubChem CID 117458641) has the molecular formula C15H21ClO3 and a molecular weight of 284.78 g/mol. Its IUPAC name is 2-(2-chloro-4-cyclopentyloxy-5-methoxyphenyl)propan-1-ol.
| Compound Name | 2-(2-chloro-4-cyclopentyloxy-5-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117458641 |
| Molecular Formula | C15H21ClO3 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-(2-chloro-4-cyclopentyloxy-5-methoxyphenyl)propan-1-ol |
| SMILES | COc1cc(C(C)CO)c(Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C15H21ClO3/c1-10(9-17)12-7-14(18-2)15(8-13(12)16)19-11-5-3-4-6-11/h7-8,10-11,17H,3-6,9H2,1-2H3 |
| InChIKey | FNSZOXGJPBXBGE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |