C21H27ClNO2+ — CID 7454850
(2-chloro-4-cyclopentyloxy-5-methoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium (PubChem CID 7454850) has the molecular formula C21H27ClNO2+ and a molecular weight of 360.91 g/mol. Its IUPAC name is (2-chloro-4-cyclopentyloxy-5-methoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium.
| Compound Name | (2-chloro-4-cyclopentyloxy-5-methoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 7454850 |
| Molecular Formula | C21H27ClNO2+ |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (2-chloro-4-cyclopentyloxy-5-methoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium |
| SMILES | COc1cc(C[NH2+][C@@H](C)c2ccccc2)c(Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H26ClNO2/c1-15(16-8-4-3-5-9-16)23-14-17-12-20(24-2)21(13-19(17)22)25-18-10-6-7-11-18/h3-5,8-9,12-13,15,18,23H,6-7,10-11,14H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | NYRCOYJBNCJKQQ-HNNXBMFYSA-O |
| XLogP | 4.49 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |