C20H31N — CID 117460035
1-[4-(4-tert-butylcyclohexyl)phenyl]cyclobutan-1-amine (PubChem CID 117460035) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is 1-[4-(4-tert-butylcyclohexyl)phenyl]cyclobutan-1-amine.
| Compound Name | 1-[4-(4-tert-butylcyclohexyl)phenyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 117460035 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 1-[4-(4-tert-butylcyclohexyl)phenyl]cyclobutan-1-amine |
| SMILES | CC(C)(C)C1CCC(c2ccc(C3(N)CCC3)cc2)CC1 |
| InChI | InChI=1S/C20H31N/c1-19(2,3)17-9-5-15(6-10-17)16-7-11-18(12-8-16)20(21)13-4-14-20/h7-8,11-12,15,17H,4-6,9-10,13-14,21H2,1-3H3 |
| InChIKey | JMVBCOFMUDFWPA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |