C20H28O2 — CID 66903085
3-[4-(4-tert-butylcyclohexyl)phenyl]-2-methylprop-2-enoic acid (PubChem CID 66903085) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 3-[4-(4-tert-butylcyclohexyl)phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-(4-tert-butylcyclohexyl)phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 66903085 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 3-[4-(4-tert-butylcyclohexyl)phenyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1ccc(C2CCC(C(C)(C)C)CC2)cc1)C(=O)O |
| InChI | InChI=1S/C20H28O2/c1-14(19(21)22)13-15-5-7-16(8-6-15)17-9-11-18(12-10-17)20(2,3)4/h5-8,13,17-18H,9-12H2,1-4H3,(H,21,22) |
| InChIKey | YUIWDVMYIAENST-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|