C13H14O2 — CID 79984292
3-(3-cyclopropylphenyl)-2-methylprop-2-enoic acid (PubChem CID 79984292) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-(3-cyclopropylphenyl)-2-methylprop-2-enoic acid.
| Compound Name | 3-(3-cyclopropylphenyl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 79984292 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-(3-cyclopropylphenyl)-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1cccc(C2CC2)c1)C(=O)O |
| InChI | InChI=1S/C13H14O2/c1-9(13(14)15)7-10-3-2-4-12(8-10)11-5-6-11/h2-4,7-8,11H,5-6H2,1H3,(H,14,15) |
| InChIKey | MVYBACSJRSMFDP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|