C17H21NO3 — CID 117463774
1-(3,3-dimethyl-2-oxo-1H-indol-5-yl)cyclohexane-1-carboxylic acid (PubChem CID 117463774) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxo-1H-indol-5-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(3,3-dimethyl-2-oxo-1H-indol-5-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117463774 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxo-1H-indol-5-yl)cyclohexane-1-carboxylic acid |
| SMILES | CC1(C)C(=O)Nc2ccc(C3(C(=O)O)CCCCC3)cc21 |
| InChI | InChI=1S/C17H21NO3/c1-16(2)12-10-11(6-7-13(12)18-14(16)19)17(15(20)21)8-4-3-5-9-17/h6-7,10H,3-5,8-9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | OOWJDNAMWQZQQU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |