C18H25NO2 — CID 117463972
1-[4-(2-pyrrolidin-1-ylethyl)phenyl]cyclopentane-1-carboxylic acid (PubChem CID 117463972) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-[4-(2-pyrrolidin-1-ylethyl)phenyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[4-(2-pyrrolidin-1-ylethyl)phenyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117463972 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-[4-(2-pyrrolidin-1-ylethyl)phenyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(CCN3CCCC3)cc2)CCCC1 |
| InChI | InChI=1S/C18H25NO2/c20-17(21)18(10-1-2-11-18)16-7-5-15(6-8-16)9-14-19-12-3-4-13-19/h5-8H,1-4,9-14H2,(H,20,21) |
| InChIKey | RSAOOSMREGZXSR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |