C17H24N2O2 — CID 117466051
1-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 117466051) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117466051 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CN1CCN(CCc2ccc(C3(C(=O)O)CC3)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-18-10-12-19(13-11-18)9-6-14-2-4-15(5-3-14)17(7-8-17)16(20)21/h2-5H,6-13H2,1H3,(H,20,21) |
| InChIKey | RUTKKMWWFFAAIJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |