C18H25NO2 — CID 117464016
2-(1-isocyanatocyclopropyl)-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 117464016) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(1-isocyanatocyclopropyl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(1-isocyanatocyclopropyl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 117464016 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-(1-isocyanatocyclopropyl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(C2(N=C=O)CC2)c1 |
| InChI | InChI=1S/C18H25NO2/c1-16(2,3)11-17(4,5)13-6-7-15(21)14(10-13)18(8-9-18)19-12-20/h6-7,10,21H,8-9,11H2,1-5H3 |
| InChIKey | FOSRJLMRTPMSJW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|