C14H17NO2 — CID 117112521
2-[3-(1-isocyanatocyclopropyl)phenyl]-2-methylpropan-1-ol (PubChem CID 117112521) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-[3-(1-isocyanatocyclopropyl)phenyl]-2-methylpropan-1-ol.
| Compound Name | 2-[3-(1-isocyanatocyclopropyl)phenyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117112521 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-[3-(1-isocyanatocyclopropyl)phenyl]-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)c1cccc(C2(N=C=O)CC2)c1 |
| InChI | InChI=1S/C14H17NO2/c1-13(2,9-16)11-4-3-5-12(8-11)14(6-7-14)15-10-17/h3-5,8,16H,6-7,9H2,1-2H3 |
| InChIKey | TVGPWFDMDSBNKY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|