C13H13F2NO — CID 117346277
1-(2,2-difluoropropyl)-3-(1-isocyanatocyclopropyl)benzene (PubChem CID 117346277) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 1-(2,2-difluoropropyl)-3-(1-isocyanatocyclopropyl)benzene.
| Compound Name | 1-(2,2-difluoropropyl)-3-(1-isocyanatocyclopropyl)benzene |
|---|---|
| PubChem CID | 117346277 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-(2,2-difluoropropyl)-3-(1-isocyanatocyclopropyl)benzene |
| SMILES | CC(F)(F)Cc1cccc(C2(N=C=O)CC2)c1 |
| InChI | InChI=1S/C13H13F2NO/c1-12(14,15)8-10-3-2-4-11(7-10)13(5-6-13)16-9-17/h2-4,7H,5-6,8H2,1H3 |
| InChIKey | FMPYYJXNTOKRDK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|