C12H11F2NO — CID 117319194
1-(2,2-difluoroethyl)-3-(1-isocyanatocyclopropyl)benzene (PubChem CID 117319194) has the molecular formula C12H11F2NO and a molecular weight of 223.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-(1-isocyanatocyclopropyl)benzene.
| Compound Name | 1-(2,2-difluoroethyl)-3-(1-isocyanatocyclopropyl)benzene |
|---|---|
| PubChem CID | 117319194 |
| Molecular Formula | C12H11F2NO |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-(1-isocyanatocyclopropyl)benzene |
| SMILES | O=C=NC1(c2cccc(CC(F)F)c2)CC1 |
| InChI | InChI=1S/C12H11F2NO/c13-11(14)7-9-2-1-3-10(6-9)12(4-5-12)15-8-16/h1-3,6,11H,4-5,7H2 |
| InChIKey | CGAHXPJDJJSNIZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|